About (E)-3-(3,5-dimethylphenyl)prop-2-enal
(E)-3-(3,5-dimethylphenyl)prop-2-enal (PubChem CID 21498051) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is (E)-3-(3,5-dimethylphenyl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-(3,5-dimethylphenyl)prop-2-enal |
| PubChem CID | 21498051 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (E)-3-(3,5-dimethylphenyl)prop-2-enal |
| SMILES | Cc1cc(C)cc(/C=C/C=O)c1 |
| InChI | InChI=1S/C11H12O/c1-9-6-10(2)8-11(7-9)4-3-5-12/h3-8H,1-2H3/b4-3+ |
| InChIKey | QEEXMMMSNIJBHP-ONEGZZNKSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3,5-dimethylphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,5-dimethylphenyl)prop-2-enal?
The IUPAC name of (E)-3-(3,5-dimethylphenyl)prop-2-enal (CID 21498051) is (E)-3-(3,5-dimethylphenyl)prop-2-enal.
What is the SMILES notation for (E)-3-(3,5-dimethylphenyl)prop-2-enal?
The canonical SMILES for (E)-3-(3,5-dimethylphenyl)prop-2-enal is Cc1cc(C)cc(/C=C/C=O)c1.
What is the InChIKey of (E)-3-(3,5-dimethylphenyl)prop-2-enal?
The InChIKey is QEEXMMMSNIJBHP-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12O/c1-9-6-10(2)8-11(7-9)4-3-5-12/h3-8H,1-2H3/b4-3+.
What are the key properties of (E)-3-(3,5-dimethylphenyl)prop-2-enal?
(E)-3-(3,5-dimethylphenyl)prop-2-enal has a molecular weight of 160.22 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,5-dimethylphenyl)prop-2-enal is sourced from PubChem (CID 21498051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).