2,2,3,3-tetrafluoropropane-1-sulfonyl chloride

C3H3ClF4O2S — CID 21498346

IUPAC2,2,3,3-tetrafluoropropane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)CC(F)(F)C(F)F
InChIInChI=1S/C3H3ClF4O2S/c4-11(9,10)1-3(7,8)2(5)6/h2H,1H2
InChIKeyNVFNFJVPKWOWLY-UHFFFAOYSA-N
MW214.57 g/mol
LogP1.46
Rot. Bonds3

About 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride

2,2,3,3-tetrafluoropropane-1-sulfonyl chloride (PubChem CID 21498346) has the molecular formula C3H3ClF4O2S and a molecular weight of 214.57 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride.

Molecular Properties

Compound Name2,2,3,3-tetrafluoropropane-1-sulfonyl chloride
PubChem CID21498346
Molecular FormulaC3H3ClF4O2S
Molecular Weight214.57 g/mol
Exact Mass213.95
IUPAC Name2,2,3,3-tetrafluoropropane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)CC(F)(F)C(F)F
InChIInChI=1S/C3H3ClF4O2S/c4-11(9,10)1-3(7,8)2(5)6/h2H,1H2
InChIKeyNVFNFJVPKWOWLY-UHFFFAOYSA-N
XLogP1.46
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.57
LogP ≤ 51.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Ethanesulfonyl fluoride, 1,2,2,2-tetrafluoro-
CID 160613
2,2,2-Trifluoroethanesulfonyl chloride
CID 74242
2,2,2-Trifluoroethanesulfonyl fluoride
CID 12929868
1-Hexanesulfonyl chloride, 3,3,4,4,5,5,6,6,6-nonafluoro-
CID 119684
Hexafluoro-isopropylsulfonic acid
CID 14637647
4,4,4-trifluorobutane-1-sulfonyl Chloride
CID 2761176
3,3,3-Trifluoropropane-1-sulfonyl chloride
CID 2761177
4,4,5,5,5-Pentafluoropentane-1-sulfonyl chloride
CID 21973190
2,2-Difluoroethanesulfonyl chloride
CID 50989405
3,3-Difluoropropane-1-sulfonyl chloride
CID 55263296
2,2,3,3,3-Pentafluoropropane-1-sulfonyl chloride
CID 71758125
1,1,1-Trifluoropropane-2-sulfonyl chloride
CID 73994686

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride?
The IUPAC name of 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride (CID 21498346) is 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride.
What is the SMILES notation for 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride?
The canonical SMILES for 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride is O=S(=O)(Cl)CC(F)(F)C(F)F.
What is the InChIKey of 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride?
The InChIKey is NVFNFJVPKWOWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClF4O2S/c4-11(9,10)1-3(7,8)2(5)6/h2H,1H2.
What are the key properties of 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride?
2,2,3,3-tetrafluoropropane-1-sulfonyl chloride has a molecular weight of 214.57 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3-tetrafluoropropane-1-sulfonyl chloride is sourced from PubChem (CID 21498346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).