C10H4Cl3F3N4OS — CID 21498377
1-(3,4,5-trichlorophenyl)-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 21498377) has the molecular formula C10H4Cl3F3N4OS and a molecular weight of 391.59 g/mol. Its IUPAC name is 1-(3,4,5-trichlorophenyl)-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3,4,5-trichlorophenyl)-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 21498377 |
| Molecular Formula | C10H4Cl3F3N4OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1-(3,4,5-trichlorophenyl)-3-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1cc(Cl)c(Cl)c(Cl)c1)Nc1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H4Cl3F3N4OS/c11-4-1-3(2-5(12)6(4)13)17-8(21)18-9-20-19-7(22-9)10(14,15)16/h1-2H,(H2,17,18,20,21) |
| InChIKey | RQEILMBBYAQKDH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|