C11H22N2O4S — CID 21498587
2-[4-(2-hydroxyethyl)-3-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol (PubChem CID 21498587) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)-3-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol.
| Compound Name | 2-[4-(2-hydroxyethyl)-3-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
|---|---|
| PubChem CID | 21498587 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)-3-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
| SMILES | CC1CN(CCO)C2CS(=O)(=O)CC2N1CCO |
| InChI | InChI=1S/C11H22N2O4S/c1-9-6-12(2-4-14)10-7-18(16,17)8-11(10)13(9)3-5-15/h9-11,14-15H,2-8H2,1H3 |
| InChIKey | ZXGHDPMTWLIFFP-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |