C14H21NO — CID 21498610
6-methoxy-2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline (PubChem CID 21498610) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-methoxy-2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline.
| Compound Name | 6-methoxy-2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 21498610 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-methoxy-2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline |
| SMILES | COc1cc2c(cc1C)NC(C)(C)CC2C |
| InChI | InChI=1S/C14H21NO/c1-9-6-12-11(7-13(9)16-5)10(2)8-14(3,4)15-12/h6-7,10,15H,8H2,1-5H3 |
| InChIKey | CAPBBOOKJDERSV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|