C19H22ClN — CID 21498615
1-benzyl-7-chloro-2,2,4-trimethyl-3,4-dihydroquinoline (PubChem CID 21498615) has the molecular formula C19H22ClN and a molecular weight of 299.84 g/mol. Its IUPAC name is 1-benzyl-7-chloro-2,2,4-trimethyl-3,4-dihydroquinoline.
| Compound Name | 1-benzyl-7-chloro-2,2,4-trimethyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 21498615 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-benzyl-7-chloro-2,2,4-trimethyl-3,4-dihydroquinoline |
| SMILES | CC1CC(C)(C)N(Cc2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H22ClN/c1-14-12-19(2,3)21(13-15-7-5-4-6-8-15)18-11-16(20)9-10-17(14)18/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | NOMTWZMSIUCDCX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |