About N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine
N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 21498701) has the molecular formula C13H30N6
and a molecular weight of 270.42 g/mol. Its IUPAC name is N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
| PubChem CID | 21498701 |
| Molecular Formula | C13H30N6 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.25 |
| IUPAC Name | N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CCC1=NCCN1CCNCCNCCNCCN |
| InChI | InChI=1S/C13H30N6/c1-2-13-18-10-12-19(13)11-9-17-8-7-16-6-5-15-4-3-14/h15-17H,2-12,14H2,1H3 |
| InChIKey | IULBZOVIUJTZHT-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine?
The IUPAC name of N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine (CID 21498701) is N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine is CCC1=NCCN1CCNCCNCCNCCN.
What is the InChIKey of N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine?
The InChIKey is IULBZOVIUJTZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N6/c1-2-13-18-10-12-19(13)11-9-17-8-7-16-6-5-15-4-3-14/h15-17H,2-12,14H2,1H3.
What are the key properties of N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine?
N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine has a molecular weight of 270.42 g/mol, XLogP of -1.16, 12 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[2-[2-(2-ethyl-4,5-dihydroimidazol-1-yl)ethylamino]ethylamino]ethyl]ethane-1,2-diamine is sourced from PubChem (CID 21498701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).