About N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide
N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide (PubChem CID 21499339) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide |
| PubChem CID | 21499339 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCc1cc(CCC)c(O)c(CCC)c1 |
| InChI | InChI=1S/C17H25NO2/c1-5-7-14-9-13(11-18-17(20)12(3)4)10-15(8-6-2)16(14)19/h9-10,19H,3,5-8,11H2,1-2,4H3,(H,18,20) |
| InChIKey | QPOGENKPVLBGRO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide?
The IUPAC name of N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide (CID 21499339) is N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide?
The canonical SMILES for N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide is C=C(C)C(=O)NCc1cc(CCC)c(O)c(CCC)c1.
What is the InChIKey of N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide?
The InChIKey is QPOGENKPVLBGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-5-7-14-9-13(11-18-17(20)12(3)4)10-15(8-6-2)16(14)19/h9-10,19H,3,5-8,11H2,1-2,4H3,(H,18,20).
What are the key properties of N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide?
N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide has a molecular weight of 275.39 g/mol, XLogP of 3.49, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-hydroxy-3,5-dipropylphenyl)methyl]-2-methylprop-2-enamide is sourced from PubChem (CID 21499339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).