About 1H-pyrido[4,3-b]indole
1H-pyrido[4,3-b]indole (PubChem CID 21499447) has the molecular formula C11H8N2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 1H-pyrido[4,3-b]indole |
| PubChem CID | 21499447 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1H-pyrido[4,3-b]indole |
| SMILES | C1=NCC2=c3ccccc3=NC2=C1 |
| InChI | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-6H,7H2 |
| InChIKey | WYZFLCYTROCEOJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrido[4,3-b]indole?
The IUPAC name of 1H-pyrido[4,3-b]indole (CID 21499447) is 1H-pyrido[4,3-b]indole.
What is the SMILES notation for 1H-pyrido[4,3-b]indole?
The canonical SMILES for 1H-pyrido[4,3-b]indole is C1=NCC2=c3ccccc3=NC2=C1.
What is the InChIKey of 1H-pyrido[4,3-b]indole?
The InChIKey is WYZFLCYTROCEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-6H,7H2.
What are the key properties of 1H-pyrido[4,3-b]indole?
1H-pyrido[4,3-b]indole has a molecular weight of 168.20 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrido[4,3-b]indole is sourced from PubChem (CID 21499447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).