About 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide
2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide (PubChem CID 2149946) has the molecular formula C10H15N3O4
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 2149946 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide |
| SMILES | CCN(CCO)C(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O4/c1-2-13(3-4-14)9(16)6-7-5-8(15)12-10(17)11-7/h5,14H,2-4,6H2,1H3,(H2,11,12,15,17) |
| InChIKey | WGKWMIIBWIKRAI-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide?
The IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide (CID 2149946) is 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide is CCN(CCO)C(=O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide?
The InChIKey is WGKWMIIBWIKRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-2-13(3-4-14)9(16)6-7-5-8(15)12-10(17)11-7/h5,14H,2-4,6H2,1H3,(H2,11,12,15,17).
What are the key properties of 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide?
2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide has a molecular weight of 241.25 g/mol, XLogP of -1.55, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1H-pyrimidin-6-yl)-N-ethyl-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 2149946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).