About 2-(4-bromophenyl)hexyl methanesulfonate
2-(4-bromophenyl)hexyl methanesulfonate (PubChem CID 21499542) has the molecular formula C13H19BrO3S
and a molecular weight of 335.26 g/mol. Its IUPAC name is 2-(4-bromophenyl)hexyl methanesulfonate.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)hexyl methanesulfonate |
| PubChem CID | 21499542 |
| Molecular Formula | C13H19BrO3S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-(4-bromophenyl)hexyl methanesulfonate |
| SMILES | CCCCC(COS(C)(=O)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrO3S/c1-3-4-5-12(10-17-18(2,15)16)11-6-8-13(14)9-7-11/h6-9,12H,3-5,10H2,1-2H3 |
| InChIKey | MDEWNOQNXOYQPC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)hexyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)hexyl methanesulfonate?
The IUPAC name of 2-(4-bromophenyl)hexyl methanesulfonate (CID 21499542) is 2-(4-bromophenyl)hexyl methanesulfonate.
What is the SMILES notation for 2-(4-bromophenyl)hexyl methanesulfonate?
The canonical SMILES for 2-(4-bromophenyl)hexyl methanesulfonate is CCCCC(COS(C)(=O)=O)c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)hexyl methanesulfonate?
The InChIKey is MDEWNOQNXOYQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BrO3S/c1-3-4-5-12(10-17-18(2,15)16)11-6-8-13(14)9-7-11/h6-9,12H,3-5,10H2,1-2H3.
What are the key properties of 2-(4-bromophenyl)hexyl methanesulfonate?
2-(4-bromophenyl)hexyl methanesulfonate has a molecular weight of 335.26 g/mol, XLogP of 3.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)hexyl methanesulfonate is sourced from PubChem (CID 21499542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).