About 3,4-diiminocyclohexa-1,5-dien-1-amine
3,4-diiminocyclohexa-1,5-dien-1-amine (PubChem CID 21499769) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 3,4-diiminocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3,4-diiminocyclohexa-1,5-dien-1-amine |
| PubChem CID | 21499769 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 3,4-diiminocyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C1\C=CC(N)=C\C1=N/[H] |
| InChI | InChI=1S/C6H7N3/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H,7H2/b8-5+,9-6+ |
| InChIKey | AIPLDZOKCCXLFJ-XVYDYJIPSA-N |
| XLogP | 0.44 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiminocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiminocyclohexa-1,5-dien-1-amine?
The IUPAC name of 3,4-diiminocyclohexa-1,5-dien-1-amine (CID 21499769) is 3,4-diiminocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3,4-diiminocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3,4-diiminocyclohexa-1,5-dien-1-amine is [H]/N=C1\C=CC(N)=C\C1=N/[H].
What is the InChIKey of 3,4-diiminocyclohexa-1,5-dien-1-amine?
The InChIKey is AIPLDZOKCCXLFJ-XVYDYJIPSA-N. The full InChI is InChI=1S/C6H7N3/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H,7H2/b8-5+,9-6+.
What are the key properties of 3,4-diiminocyclohexa-1,5-dien-1-amine?
3,4-diiminocyclohexa-1,5-dien-1-amine has a molecular weight of 121.14 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiminocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 21499769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).