C20H15N2O3S- — CID 2150183
2-[(9-methyl-2-phenyl-5H-chromeno[2,3-d]pyrimidin-4-yl)sulfanyl]acetate (PubChem CID 2150183) has the molecular formula C20H15N2O3S- and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[(9-methyl-2-phenyl-5H-chromeno[2,3-d]pyrimidin-4-yl)sulfanyl]acetate.
| Compound Name | 2-[(9-methyl-2-phenyl-5H-chromeno[2,3-d]pyrimidin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2150183 |
| Molecular Formula | C20H15N2O3S- |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[(9-methyl-2-phenyl-5H-chromeno[2,3-d]pyrimidin-4-yl)sulfanyl]acetate |
| SMILES | Cc1cccc2c1Oc1nc(-c3ccccc3)nc(SCC(=O)[O-])c1C2 |
| InChI | InChI=1S/C20H16N2O3S/c1-12-6-5-9-14-10-15-19(25-17(12)14)21-18(13-7-3-2-4-8-13)22-20(15)26-11-16(23)24/h2-9H,10-11H2,1H3,(H,23,24)/p-1 |
| InChIKey | BTYZXLSNCSMORL-UHFFFAOYSA-M |
| XLogP | 2.99 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |