About 2,7-dinitro-9H-fluorene
2,7-dinitro-9H-fluorene (PubChem CID 21502) has the molecular formula C13H8N2O4
and a molecular weight of 256.22 g/mol. Its IUPAC name is 2,7-dinitro-9H-fluorene.
Molecular Properties
| Compound Name | 2,7-dinitro-9H-fluorene |
| PubChem CID | 21502 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2,7-dinitro-9H-fluorene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C13H8N2O4/c16-14(17)10-1-3-12-8(6-10)5-9-7-11(15(18)19)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChIKey | IHZCVUBSTYOFSJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dinitro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dinitro-9H-fluorene?
The IUPAC name of 2,7-dinitro-9H-fluorene (CID 21502) is 2,7-dinitro-9H-fluorene.
What is the SMILES notation for 2,7-dinitro-9H-fluorene?
The canonical SMILES for 2,7-dinitro-9H-fluorene is O=[N+]([O-])c1ccc2c(c1)Cc1cc([N+](=O)[O-])ccc1-2.
What is the InChIKey of 2,7-dinitro-9H-fluorene?
The InChIKey is IHZCVUBSTYOFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O4/c16-14(17)10-1-3-12-8(6-10)5-9-7-11(15(18)19)2-4-13(9)12/h1-4,6-7H,5H2.
What are the key properties of 2,7-dinitro-9H-fluorene?
2,7-dinitro-9H-fluorene has a molecular weight of 256.22 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dinitro-9H-fluorene is sourced from PubChem (CID 21502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).