C10H16N3OS+ — CID 2150388
6-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one (PubChem CID 2150388) has the molecular formula C10H16N3OS+ and a molecular weight of 226.32 g/mol. Its IUPAC name is 6-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one.
| Compound Name | 6-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
|---|---|
| PubChem CID | 2150388 |
| Molecular Formula | C10H16N3OS+ |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-propyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-6-ium-4-one |
| SMILES | CCC[NH+]1CCc2[nH]c(=S)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-4-13-5-3-8-7(6-13)9(14)12-10(15)11-8/h2-6H2,1H3,(H2,11,12,14,15)/p+1 |
| InChIKey | VHYQWHQRBZHKRF-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|