About 1,3-benzothiazole-2,6-diamine
1,3-benzothiazole-2,6-diamine (PubChem CID 21504) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 1,3-benzothiazole-2,6-diamine.
Molecular Properties
| Compound Name | 1,3-benzothiazole-2,6-diamine |
| PubChem CID | 21504 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C7H7N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,8H2,(H2,9,10) |
| InChIKey | HYBCFWFWKXJYFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole-2,6-diamine?
The IUPAC name of 1,3-benzothiazole-2,6-diamine (CID 21504) is 1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for 1,3-benzothiazole-2,6-diamine?
The canonical SMILES for 1,3-benzothiazole-2,6-diamine is Nc1ccc2nc(N)sc2c1.
What is the InChIKey of 1,3-benzothiazole-2,6-diamine?
The InChIKey is HYBCFWFWKXJYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,8H2,(H2,9,10).
What are the key properties of 1,3-benzothiazole-2,6-diamine?
1,3-benzothiazole-2,6-diamine has a molecular weight of 165.22 g/mol, XLogP of 1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 21504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).