C24H15F5N2O2S — CID 2150734
[3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenylacetate (PubChem CID 2150734) has the molecular formula C24H15F5N2O2S and a molecular weight of 490.45 g/mol. Its IUPAC name is [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenylacetate.
| Compound Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 2150734 |
| Molecular Formula | C24H15F5N2O2S |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [3-methyl-4-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-phenylpyrazol-5-yl] 2-phenylacetate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)Cc2ccccc2)c1Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H15F5N2O2S/c1-13-22(34-23-20(28)18(26)17(25)19(27)21(23)29)24(31(30-13)15-10-6-3-7-11-15)33-16(32)12-14-8-4-2-5-9-14/h2-11H,12H2,1H3 |
| InChIKey | NZDFOJPHCGRDKT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|