About 4-Aminoantipyrine
4-Aminoantipyrine (PubChem CID 2151) has the molecular formula C11H13N3O
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-Aminoantipyrine |
| PubChem CID | 2151 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
| InChI | InChI=1S/C11H13N3O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,12H2,1-2H3 |
| InChIKey | RLFWWDJHLFCNIJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 305 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-Aminoantipyrine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Aminoantipyrine?
The IUPAC name of 4-Aminoantipyrine (CID 2151) is 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one.
What is the SMILES notation for 4-Aminoantipyrine?
The canonical SMILES for 4-Aminoantipyrine is CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N.
What is the InChIKey of 4-Aminoantipyrine?
The InChIKey is RLFWWDJHLFCNIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,12H2,1-2H3.
What are the key properties of 4-Aminoantipyrine?
4-Aminoantipyrine has a molecular weight of 203.24 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Aminoantipyrine is sourced from PubChem (CID 2151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).