About 2,8-dichlorodibenzofuran
2,8-dichlorodibenzofuran (PubChem CID 21510) has the molecular formula C12H6Cl2O
and a molecular weight of 237.09 g/mol. Its IUPAC name is 2,8-dichlorodibenzofuran.
Molecular Properties
| Compound Name | 2,8-dichlorodibenzofuran |
| PubChem CID | 21510 |
| Molecular Formula | C12H6Cl2O |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 2,8-dichlorodibenzofuran |
| SMILES | Clc1ccc2oc3ccc(Cl)cc3c2c1 |
| InChI | InChI=1S/C12H6Cl2O/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H |
| InChIKey | IVVRJIDVYSPKFZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,8-dichlorodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dichlorodibenzofuran?
The IUPAC name of 2,8-dichlorodibenzofuran (CID 21510) is 2,8-dichlorodibenzofuran.
What is the SMILES notation for 2,8-dichlorodibenzofuran?
The canonical SMILES for 2,8-dichlorodibenzofuran is Clc1ccc2oc3ccc(Cl)cc3c2c1.
What is the InChIKey of 2,8-dichlorodibenzofuran?
The InChIKey is IVVRJIDVYSPKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2O/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H.
What are the key properties of 2,8-dichlorodibenzofuran?
2,8-dichlorodibenzofuran has a molecular weight of 237.09 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dichlorodibenzofuran is sourced from PubChem (CID 21510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).