About 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide
2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide (PubChem CID 21511016) has the molecular formula C25H22BrN
and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide.
Molecular Properties
| Compound Name | 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide |
| PubChem CID | 21511016 |
| Molecular Formula | C25H22BrN |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide |
| SMILES | C1C=C2C(=C(C3=CC=CC=C23)C4=CC=CC=C4)CN1CC5=CC=CC=C5.Br |
| InChI | InChI=1S/C25H21N.BrH/c1-3-9-19(10-4-1)17-26-16-15-22-21-13-7-8-14-23(21)25(24(22)18-26)20-11-5-2-6-12-20;/h1-15H,16-18H2;1H |
| InChIKey | VQILBAOKFWGFNU-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 3.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | 559 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide?
The IUPAC name of 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide (CID 21511016) is 2-benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide.
What is the SMILES notation for 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide?
The canonical SMILES for 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide is C1C=C2C(=C(C3=CC=CC=C23)C4=CC=CC=C4)CN1CC5=CC=CC=C5.Br.
What is the InChIKey of 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide?
The InChIKey is VQILBAOKFWGFNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N.BrH/c1-3-9-19(10-4-1)17-26-16-15-22-21-13-7-8-14-23(21)25(24(22)18-26)20-11-5-2-6-12-20;/h1-15H,16-18H2;1H.
What are the key properties of 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide?
2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide has a molecular weight of 416.40 g/mol, XLogP of not available, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Benzyl-9-phenyl-1,3-dihydroindeno[2,1-c]pyridine;hydrobromide is sourced from PubChem (CID 21511016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).