C31H28N4O4 — CID 2152493
ethyl 7-cyclohexyl-6-(naphthalene-2-carbonylimino)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2152493) has the molecular formula C31H28N4O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is ethyl 7-cyclohexyl-6-(naphthalene-2-carbonylimino)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-cyclohexyl-6-(naphthalene-2-carbonylimino)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2152493 |
| Molecular Formula | C31H28N4O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | ethyl 7-cyclohexyl-6-(naphthalene-2-carbonylimino)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C2CCCCC2)/c1=N/C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H28N4O4/c1-2-39-31(38)25-19-24-27(32-26-14-8-9-17-34(26)30(24)37)35(23-12-4-3-5-13-23)28(25)33-29(36)22-16-15-20-10-6-7-11-21(20)18-22/h6-11,14-19,23H,2-5,12-13H2,1H3/b33-28+ |
| InChIKey | UVAKEQKYGXTWRP-PJJLUWSFSA-N |
| XLogP | 5.23 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|