About Ochrolifuanine A
Ochrolifuanine A (PubChem CID 215338) has the molecular formula C29H34N4
and a molecular weight of 438.60 g/mol. Its IUPAC name is (2S,3R,12bS)-3-ethyl-2-[[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl]-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine.
Molecular Properties
| Compound Name | Ochrolifuanine A |
| PubChem CID | 215338 |
| Molecular Formula | C29H34N4 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2S,3R,12bS)-3-ethyl-2-[[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl]-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine |
| SMILES | CC[C@H]1CN2CCC3=C([C@@H]2C[C@@H]1C[C@@H]4C5=C(CCN4)C6=CC=CC=C6N5)NC7=CC=CC=C37 |
| InChI | InChI=1S/C29H34N4/c1-2-18-17-33-14-12-23-21-8-4-6-10-25(21)32-29(23)27(33)16-19(18)15-26-28-22(11-13-30-26)20-7-3-5-9-24(20)31-28/h3-10,18-19,26-27,30-32H,2,11-17H2,1H3/t18-,19-,26+,27-/m0/s1 |
| InChIKey | BYHWAEAVIGYEBJ-QJTMEEEXSA-N |
| XLogP | 5.20 |
| TPSA | 46.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | 697 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze Ochrolifuanine A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ochrolifuanine A?
The IUPAC name of Ochrolifuanine A (CID 215338) is (2S,3R,12bS)-3-ethyl-2-[[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl]-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine.
What is the SMILES notation for Ochrolifuanine A?
The canonical SMILES for Ochrolifuanine A is CC[C@H]1CN2CCC3=C([C@@H]2C[C@@H]1C[C@@H]4C5=C(CCN4)C6=CC=CC=C6N5)NC7=CC=CC=C37.
What is the InChIKey of Ochrolifuanine A?
The InChIKey is BYHWAEAVIGYEBJ-QJTMEEEXSA-N. The full InChI is InChI=1S/C29H34N4/c1-2-18-17-33-14-12-23-21-8-4-6-10-25(21)32-29(23)27(33)16-19(18)15-26-28-22(11-13-30-26)20-7-3-5-9-24(20)31-28/h3-10,18-19,26-27,30-32H,2,11-17H2,1H3/t18-,19-,26+,27-/m0/s1.
What are the key properties of Ochrolifuanine A?
Ochrolifuanine A has a molecular weight of 438.60 g/mol, XLogP of 5.20, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Ochrolifuanine A is sourced from PubChem (CID 215338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).