About (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate (PubChem CID 2153771) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate.
Molecular Properties
| Compound Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate |
| PubChem CID | 2153771 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2c(Sc3ccccc3)c(C)nn2C(C)(C)C)c1 |
| InChI | InChI=1S/C22H24N2O2S/c1-15-10-9-11-17(14-15)21(25)26-20-19(27-18-12-7-6-8-13-18)16(2)23-24(20)22(3,4)5/h6-14H,1-5H3 |
| InChIKey | FBBJOLDHLGYGNW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate?
The IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate (CID 2153771) is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate.
What is the SMILES notation for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate?
The canonical SMILES for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate is Cc1cccc(C(=O)Oc2c(Sc3ccccc3)c(C)nn2C(C)(C)C)c1.
What is the InChIKey of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate?
The InChIKey is FBBJOLDHLGYGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c1-15-10-9-11-17(14-15)21(25)26-20-19(27-18-12-7-6-8-13-18)16(2)23-24(20)22(3,4)5/h6-14H,1-5H3.
What are the key properties of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate?
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate has a molecular weight of 380.51 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 3-methylbenzoate is sourced from PubChem (CID 2153771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).