About (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate (PubChem CID 2153774) has the molecular formula C22H24N2O3S
and a molecular weight of 396.51 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate.
Molecular Properties
| Compound Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate |
| PubChem CID | 2153774 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1c(Sc2ccccc2)c(C)nn1C(C)(C)C |
| InChI | InChI=1S/C22H24N2O3S/c1-15-19(28-16-11-7-6-8-12-16)20(24(23-15)22(2,3)4)27-21(25)17-13-9-10-14-18(17)26-5/h6-14H,1-5H3 |
| InChIKey | JSVHAQUEBIUUSR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate?
The IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate (CID 2153774) is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate.
What is the SMILES notation for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate?
The canonical SMILES for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate is COc1ccccc1C(=O)Oc1c(Sc2ccccc2)c(C)nn1C(C)(C)C.
What is the InChIKey of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate?
The InChIKey is JSVHAQUEBIUUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3S/c1-15-19(28-16-11-7-6-8-12-16)20(24(23-15)22(2,3)4)27-21(25)17-13-9-10-14-18(17)26-5/h6-14H,1-5H3.
What are the key properties of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate?
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate has a molecular weight of 396.51 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2-methoxybenzoate is sourced from PubChem (CID 2153774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).