C26H25FN2O4S — CID 2156519
N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2156519) has the molecular formula C26H25FN2O4S and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2156519 |
| Molecular Formula | C26H25FN2O4S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCSc2c(-c3ccc(F)cc3)[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H25FN2O4S/c1-31-21-14-17(15-22(32-2)24(21)33-3)26(30)28-12-13-34-25-19-6-4-5-7-20(19)29-23(25)16-8-10-18(27)11-9-16/h4-11,14-15,29H,12-13H2,1-3H3,(H,28,30) |
| InChIKey | JECKLPBVVSTJGG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|