C21H38O3S — CID 21566173
2-(6-Carbethoxyhexyl)-3-heptylthio-cyclopentanone (PubChem CID 21566173) has the molecular formula C21H38O3S and a molecular weight of 370.60 g/mol. Its IUPAC name is ethyl 7-(2-heptylsulfanyl-5-oxocyclopentyl)heptanoate.
| Compound Name | 2-(6-Carbethoxyhexyl)-3-heptylthio-cyclopentanone |
|---|---|
| PubChem CID | 21566173 |
| Molecular Formula | C21H38O3S |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl 7-(2-heptylsulfanyl-5-oxocyclopentyl)heptanoate |
| SMILES | CCCCCCCSC1CCC(=O)C1CCCCCCC(=O)OCC |
| InChI | InChI=1S/C21H38O3S/c1-3-5-6-9-12-17-25-20-16-15-19(22)18(20)13-10-7-8-11-14-21(23)24-4-2/h18,20H,3-17H2,1-2H3 |
| InChIKey | KKVIWYQNZBEDOA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 68.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | 370 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|