C20H22N2O3S — CID 2157580
N-(2,5-dimethylphenyl)-2-(1-ethylindol-3-yl)sulfonylacetamide (PubChem CID 2157580) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(1-ethylindol-3-yl)sulfonylacetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(1-ethylindol-3-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 2157580 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(1-ethylindol-3-yl)sulfonylacetamide |
| SMILES | CCn1cc(S(=O)(=O)CC(=O)Nc2cc(C)ccc2C)c2ccccc21 |
| InChI | InChI=1S/C20H22N2O3S/c1-4-22-12-19(16-7-5-6-8-18(16)22)26(24,25)13-20(23)21-17-11-14(2)9-10-15(17)3/h5-12H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | ZHRVXEKEOMUAJO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |