C24H35NO9 — CID 21581857
tert-butyl (3aR,4S,6aS)-4-[(2S,3S)-2,3-dihydroxy-4-(4-methoxybenzoyl)oxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 21581857) has the molecular formula C24H35NO9 and a molecular weight of 481.50 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6aS)-4-[(2S,3S)-2,3-dihydroxy-4-(4-methoxybenzoyl)oxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6aS)-4-[(2S,3S)-2,3-dihydroxy-4-(4-methoxybenzoyl)oxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 21581857 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | tert-butyl (3aR,4S,6aS)-4-[(2S,3S)-2,3-dihydroxy-4-(4-methoxybenzoyl)oxybutyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC1(O[C@H]2CN([C@H]([C@H]2O1)C[C@@H]([C@H](COC(=O)C3=CC=C(C=C3)OC)O)O)C(=O)OC(C)(C)C)C |
| InChI | InChI=1S/C24H35NO9/c1-23(2,3)34-22(29)25-12-19-20(33-24(4,5)32-19)16(25)11-17(26)18(27)13-31-21(28)14-7-9-15(30-6)10-8-14/h7-10,16-20,26-27H,11-13H2,1-6H3/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | GMVIRVBLHUYGCQ-VYJAJWGXSA-N |
| XLogP | 1.90 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | 714 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |