About 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide
2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 2158846) has the molecular formula C15H17N3O2S3
and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2158846 |
| Molecular Formula | C15H17N3O2S3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSCC(=O)N1CCCC1)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C15H17N3O2S3/c19-13(9-21-10-14(20)18-5-1-2-6-18)17-15-16-11(8-23-15)12-4-3-7-22-12/h3-4,7-8H,1-2,5-6,9-10H2,(H,16,17,19) |
| InChIKey | ZEATZGPJUJMZTB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (CID 2158846) is 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide is O=C(CSCC(=O)N1CCCC1)Nc1nc(-c2cccs2)cs1.
What is the InChIKey of 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide?
The InChIKey is ZEATZGPJUJMZTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S3/c19-13(9-21-10-14(20)18-5-1-2-6-18)17-15-16-11(8-23-15)12-4-3-7-22-12/h3-4,7-8H,1-2,5-6,9-10H2,(H,16,17,19).
What are the key properties of 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide?
2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide has a molecular weight of 367.52 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2158846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).