About 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate
2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate (PubChem CID 21591) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate |
| PubChem CID | 21591 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate |
| SMILES | CCN(CC)CCOC(=O)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-3-22(4-2)15-16-24-21(23)17-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17H,3-4,15-16H2,1-2H3 |
| InChIKey | XIROWYXRKYJPMU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate?
The IUPAC name of 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate (CID 21591) is 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate.
What is the SMILES notation for 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate?
The canonical SMILES for 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate is CCN(CC)CCOC(=O)C=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate?
The InChIKey is XIROWYXRKYJPMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-3-22(4-2)15-16-24-21(23)17-20(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17H,3-4,15-16H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate?
2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate has a molecular weight of 323.44 g/mol, XLogP of 4.00, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3,3-diphenylprop-2-enoate is sourced from PubChem (CID 21591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).