C12H23NO8 — CID 21591966
4-O-beta-D-glucopyranosyl-fagomine (PubChem CID 21591966) has the molecular formula C12H23NO8 and a molecular weight of 309.31 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 4-O-beta-D-glucopyranosyl-fagomine |
|---|---|
| PubChem CID | 21591966 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R,3R,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C1CN[C@@H]([C@H]([C@@H]1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CO |
| InChI | InChI=1S/C12H23NO8/c14-3-5-11(6(16)1-2-13-5)21-12-10(19)9(18)8(17)7(4-15)20-12/h5-19H,1-4H2/t5-,6-,7-,8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | SBRQYNWRPMAGGE-WUYFHPBOSA-N |
| XLogP | -3.50 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 332 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |