About ethyl 2-cyclohexylacetate
ethyl 2-cyclohexylacetate (PubChem CID 21595) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is ethyl 2-cyclohexylacetate.
Molecular Properties
| Compound Name | ethyl 2-cyclohexylacetate |
| PubChem CID | 21595 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | ethyl 2-cyclohexylacetate |
| SMILES | CCOC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C10H18O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h9H,2-8H2,1H3 |
| InChIKey | ZBDAMDWKXGTKBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyclohexylacetate?
The IUPAC name of ethyl 2-cyclohexylacetate (CID 21595) is ethyl 2-cyclohexylacetate.
What is the SMILES notation for ethyl 2-cyclohexylacetate?
The canonical SMILES for ethyl 2-cyclohexylacetate is CCOC(=O)CC1CCCCC1.
What is the InChIKey of ethyl 2-cyclohexylacetate?
The InChIKey is ZBDAMDWKXGTKBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h9H,2-8H2,1H3.
What are the key properties of ethyl 2-cyclohexylacetate?
ethyl 2-cyclohexylacetate has a molecular weight of 170.25 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyclohexylacetate is sourced from PubChem (CID 21595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).