About 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide
5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide (PubChem CID 2160268) has the molecular formula C14H16BrN3O3S
and a molecular weight of 386.27 g/mol. Its IUPAC name is 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide |
| PubChem CID | 2160268 |
| Molecular Formula | C14H16BrN3O3S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide |
| SMILES | CC(C)(C)n1nc2c(c1NC(=O)c1ccc(Br)o1)CS(=O)C2 |
| InChI | InChI=1S/C14H16BrN3O3S/c1-14(2,3)18-12(8-6-22(20)7-9(8)17-18)16-13(19)10-4-5-11(15)21-10/h4-5H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | XEGYXMYYRHTJGZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide?
The IUPAC name of 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide (CID 2160268) is 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide?
The canonical SMILES for 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide is CC(C)(C)n1nc2c(c1NC(=O)c1ccc(Br)o1)CS(=O)C2.
What is the InChIKey of 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide?
The InChIKey is XEGYXMYYRHTJGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3O3S/c1-14(2,3)18-12(8-6-22(20)7-9(8)17-18)16-13(19)10-4-5-11(15)21-10/h4-5H,6-7H2,1-3H3,(H,16,19).
What are the key properties of 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide?
5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide has a molecular weight of 386.27 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2-tert-butyl-5-oxo-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)furan-2-carboxamide is sourced from PubChem (CID 2160268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).