About (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate
(4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate (PubChem CID 21604843) has the molecular formula C14H16O6
and a molecular weight of 280.27 g/mol. Its IUPAC name is (4-acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate |
| PubChem CID | 21604843 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (4-acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate |
| SMILES | CC1=C(C(=O)C(=C(C1=O)OC(=O)C)C(C)C)OC(=O)C |
| InChI | InChI=1S/C14H16O6/c1-6(2)10-12(18)13(19-8(4)15)7(3)11(17)14(10)20-9(5)16/h6H,1-5H3 |
| InChIKey | AZZYCFIGCATJQY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | 562 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate?
The IUPAC name of (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate (CID 21604843) is (4-acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate.
What is the SMILES notation for (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate?
The canonical SMILES for (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate is CC1=C(C(=O)C(=C(C1=O)OC(=O)C)C(C)C)OC(=O)C.
What is the InChIKey of (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate?
The InChIKey is AZZYCFIGCATJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O6/c1-6(2)10-12(18)13(19-8(4)15)7(3)11(17)14(10)20-9(5)16/h6H,1-5H3.
What are the key properties of (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate?
(4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate has a molecular weight of 280.27 g/mol, XLogP of 1.50, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-Acetyloxy-2-methyl-3,6-dioxo-5-propan-2-ylcyclohexa-1,4-dien-1-yl) acetate is sourced from PubChem (CID 21604843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).