About N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide
N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 2160596) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide.
Molecular Properties
| Compound Name | N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| PubChem CID | 2160596 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NC(=O)N1CCCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c20-16(14-8-2-1-3-9-14)18-17(21)19-12-6-10-13-7-4-5-11-15(13)19/h1-5,7-9,11H,6,10,12H2,(H,18,20,21) |
| InChIKey | SCSJKQDOFMUUTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The IUPAC name of N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide (CID 2160596) is N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide.
What is the SMILES notation for N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The canonical SMILES for N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide is O=C(NC(=O)N1CCCc2ccccc21)c1ccccc1.
What is the InChIKey of N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The InChIKey is SCSJKQDOFMUUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c20-16(14-8-2-1-3-9-14)18-17(21)19-12-6-10-13-7-4-5-11-15(13)19/h1-5,7-9,11H,6,10,12H2,(H,18,20,21).
What are the key properties of N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide?
N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide has a molecular weight of 280.33 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzoyl-3,4-dihydro-2H-quinoline-1-carboxamide is sourced from PubChem (CID 2160596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).