C13H14N2O2 — CID 2161517
2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-8-carboxylate (PubChem CID 2161517) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-8-carboxylate.
| Compound Name | 2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-8-carboxylate |
|---|---|
| PubChem CID | 2161517 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-8-carboxylate |
| SMILES | C[NH+]1CCc2[nH]c3ccc(C(=O)[O-])cc3c2C1 |
| InChI | InChI=1S/C13H14N2O2/c1-15-5-4-12-10(7-15)9-6-8(13(16)17)2-3-11(9)14-12/h2-3,6,14H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | OTTRGAKRWFQDPD-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|