C17H16FN3O3S — CID 2161555
2-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-N-(2-methoxyethyl)acetamide (PubChem CID 2161555) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 2161555 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ncnc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C17H16FN3O3S/c1-23-7-6-19-14(22)8-24-16-15-13(9-25-17(15)21-10-20-16)11-2-4-12(18)5-3-11/h2-5,9-10H,6-8H2,1H3,(H,19,22) |
| InChIKey | LJPLLNPFJZMOME-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|