About [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate
[2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 2161565) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
Molecular Properties
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| PubChem CID | 2161565 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)NCc3ccco3)cc2)n1 |
| InChI | InChI=1S/C19H19N3O4/c1-13-10-14(2)22(21-13)16-7-5-15(6-8-16)19(24)26-12-18(23)20-11-17-4-3-9-25-17/h3-10H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | HCEOVHZQQHDCBM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The IUPAC name of [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate (CID 2161565) is [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate.
What is the SMILES notation for [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The canonical SMILES for [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is Cc1cc(C)n(-c2ccc(C(=O)OCC(=O)NCc3ccco3)cc2)n1.
What is the InChIKey of [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
The InChIKey is HCEOVHZQQHDCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O4/c1-13-10-14(2)22(21-13)16-7-5-15(6-8-16)19(24)26-12-18(23)20-11-17-4-3-9-25-17/h3-10H,11-12H2,1-2H3,(H,20,23).
What are the key properties of [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate?
[2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate has a molecular weight of 353.38 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-(3,5-dimethylpyrazol-1-yl)benzoate is sourced from PubChem (CID 2161565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).