About 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide
2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide (PubChem CID 2161638) has the molecular formula C16H14N4O3S3
and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide |
| PubChem CID | 2161638 |
| Molecular Formula | C16H14N4O3S3 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C16H14N4O3S3/c1-24-15-13(3-2-8-17-15)14(21)19-11-4-6-12(7-5-11)26(22,23)20-16-18-9-10-25-16/h2-10H,1H3,(H,18,20)(H,19,21) |
| InChIKey | XKUGKMJOLRUTFI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide?
The IUPAC name of 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide (CID 2161638) is 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide.
What is the SMILES notation for 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide?
The canonical SMILES for 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide is CSc1ncccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1.
What is the InChIKey of 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide?
The InChIKey is XKUGKMJOLRUTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S3/c1-24-15-13(3-2-8-17-15)14(21)19-11-4-6-12(7-5-11)26(22,23)20-16-18-9-10-25-16/h2-10H,1H3,(H,18,20)(H,19,21).
What are the key properties of 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide?
2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide has a molecular weight of 406.51 g/mol, XLogP of 3.31, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyridine-3-carboxamide is sourced from PubChem (CID 2161638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).