About 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide
1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide (PubChem CID 2161683) has the molecular formula C20H18ClFN4O2
and a molecular weight of 400.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide |
| PubChem CID | 2161683 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H18ClFN4O2/c1-12-18(13(2)26(25-12)11-14-7-3-5-9-16(14)21)20(28)24-23-19(27)15-8-4-6-10-17(15)22/h3-10H,11H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | PWZZXKUGIOIQJO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide?
The IUPAC name of 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide (CID 2161683) is 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide.
What is the SMILES notation for 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide?
The canonical SMILES for 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide is Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)NNC(=O)c1ccccc1F.
What is the InChIKey of 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide?
The InChIKey is PWZZXKUGIOIQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClFN4O2/c1-12-18(13(2)26(25-12)11-14-7-3-5-9-16(14)21)20(28)24-23-19(27)15-8-4-6-10-17(15)22/h3-10H,11H2,1-2H3,(H,23,27)(H,24,28).
What are the key properties of 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide?
1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide has a molecular weight of 400.84 g/mol, XLogP of 3.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chlorophenyl)methyl]-N'-(2-fluorobenzoyl)-3,5-dimethylpyrazole-4-carbohydrazide is sourced from PubChem (CID 2161683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).