C13H16N4O4S2 — CID 2162125
N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-4-nitrobenzenesulfonamide (PubChem CID 2162125) has the molecular formula C13H16N4O4S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2162125 |
| Molecular Formula | C13H16N4O4S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[5-(2,2-dimethylpropyl)-1,3,4-thiadiazol-2-yl]-4-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)Cc1nnc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C13H16N4O4S2/c1-13(2,3)8-11-14-15-12(22-11)16-23(20,21)10-6-4-9(5-7-10)17(18)19/h4-7H,8H2,1-3H3,(H,15,16) |
| InChIKey | JQUAWURUNNGGIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|