C18H21NO2S — CID 2163081
1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 2163081) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 2163081 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO2S/c1-18(2,3)15-8-10-16(11-9-15)22(20,21)19-13-12-14-6-4-5-7-17(14)19/h4-11H,12-13H2,1-3H3 |
| InChIKey | ZEPAQPVAZCXRCD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |