About [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate
[(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate (PubChem CID 21630841) has the molecular formula C14H22O4
and a molecular weight of 254.32 g/mol. Its IUPAC name is [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate.
Molecular Properties
| Compound Name | [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate |
| PubChem CID | 21630841 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate |
| SMILES | CC(=CCC(/C(=C/COC(=O)C)/C)OC(=O)C)C |
| InChI | InChI=1S/C14H22O4/c1-10(2)6-7-14(18-13(5)16)11(3)8-9-17-12(4)15/h6,8,14H,7,9H2,1-5H3/b11-8+ |
| InChIKey | ZDJGIZATHIZKGW-DHZHZOJOSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | 349 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate?
The IUPAC name of [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate (CID 21630841) is [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate.
What is the SMILES notation for [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate?
The canonical SMILES for [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate is CC(=CCC(/C(=C/COC(=O)C)/C)OC(=O)C)C.
What is the InChIKey of [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate?
The InChIKey is ZDJGIZATHIZKGW-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H22O4/c1-10(2)6-7-14(18-13(5)16)11(3)8-9-17-12(4)15/h6,8,14H,7,9H2,1-5H3/b11-8+.
What are the key properties of [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate?
[(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate has a molecular weight of 254.32 g/mol, XLogP of 2.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-4-acetyloxy-3,7-dimethylocta-2,6-dienyl] acetate is sourced from PubChem (CID 21630841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).