About 1-N,3-N-dibutylbenzene-1,3-dicarboxamide
1-N,3-N-dibutylbenzene-1,3-dicarboxamide (PubChem CID 2164314) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-N,3-N-dibutylbenzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-dibutylbenzene-1,3-dicarboxamide |
| PubChem CID | 2164314 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-N,3-N-dibutylbenzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)NCCCC)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-3-5-10-17-15(19)13-8-7-9-14(12-13)16(20)18-11-6-4-2/h7-9,12H,3-6,10-11H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | UEUJQJBBZXOQII-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-dibutylbenzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-dibutylbenzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-dibutylbenzene-1,3-dicarboxamide (CID 2164314) is 1-N,3-N-dibutylbenzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-dibutylbenzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-dibutylbenzene-1,3-dicarboxamide is CCCCNC(=O)c1cccc(C(=O)NCCCC)c1.
What is the InChIKey of 1-N,3-N-dibutylbenzene-1,3-dicarboxamide?
The InChIKey is UEUJQJBBZXOQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-3-5-10-17-15(19)13-8-7-9-14(12-13)16(20)18-11-6-4-2/h7-9,12H,3-6,10-11H2,1-2H3,(H,17,19)(H,18,20).
What are the key properties of 1-N,3-N-dibutylbenzene-1,3-dicarboxamide?
1-N,3-N-dibutylbenzene-1,3-dicarboxamide has a molecular weight of 276.38 g/mol, XLogP of 2.75, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-dibutylbenzene-1,3-dicarboxamide is sourced from PubChem (CID 2164314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).