C17H19N7O4 — CID 2164539
4-[[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2-ethoxy-3-nitrophenol (PubChem CID 2164539) has the molecular formula C17H19N7O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2-ethoxy-3-nitrophenol.
| Compound Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2-ethoxy-3-nitrophenol |
|---|---|
| PubChem CID | 2164539 |
| Molecular Formula | C17H19N7O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-[[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2-ethoxy-3-nitrophenol |
| SMILES | CCOc1c(O)ccc(C=Nn2c(C)nnc2-n2nc(C)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N7O4/c1-5-28-16-14(25)7-6-13(15(16)24(26)27)9-18-23-12(4)19-20-17(23)22-11(3)8-10(2)21-22/h6-9,25H,5H2,1-4H3 |
| InChIKey | PJXZCFZEHXLDKC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|