About 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one
3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one (PubChem CID 2165095) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one |
| PubChem CID | 2165095 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one |
| SMILES | Cc1cc(C)nc(SCCCn2c(=O)[nH]c3ccccc32)n1 |
| InChI | InChI=1S/C16H18N4OS/c1-11-10-12(2)18-15(17-11)22-9-5-8-20-14-7-4-3-6-13(14)19-16(20)21/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,19,21) |
| InChIKey | HRAVCEAPJMVQGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one?
The IUPAC name of 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one (CID 2165095) is 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one.
What is the SMILES notation for 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one?
The canonical SMILES for 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one is Cc1cc(C)nc(SCCCn2c(=O)[nH]c3ccccc32)n1.
What is the InChIKey of 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one?
The InChIKey is HRAVCEAPJMVQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS/c1-11-10-12(2)18-15(17-11)22-9-5-8-20-14-7-4-3-6-13(14)19-16(20)21/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,19,21).
What are the key properties of 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one?
3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one has a molecular weight of 314.41 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-1H-benzimidazol-2-one is sourced from PubChem (CID 2165095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).