C21H22F4N2O2 — CID 2165934
(4-phenylpiperazin-1-yl)-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone (PubChem CID 2165934) has the molecular formula C21H22F4N2O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is (4-phenylpiperazin-1-yl)-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone.
| Compound Name | (4-phenylpiperazin-1-yl)-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 2165934 |
| Molecular Formula | C21H22F4N2O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (4-phenylpiperazin-1-yl)-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(COCC(F)(F)C(F)F)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22F4N2O2/c22-20(23)21(24,25)15-29-14-16-5-4-6-17(13-16)19(28)27-11-9-26(10-12-27)18-7-2-1-3-8-18/h1-8,13,20H,9-12,14-15H2 |
| InChIKey | BWWWGDHMSLJEHB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|