C13H13BrN2O2S2 — CID 2166233
(5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 2166233) has the molecular formula C13H13BrN2O2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2166233 |
| Molecular Formula | C13H13BrN2O2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | (5Z)-5-[(5-bromothiophen-2-yl)methylidene]-3-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Br)s2)NC(=S)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H13BrN2O2S2/c14-11-4-3-9(20-11)6-10-12(17)16(13(19)15-10)7-8-2-1-5-18-8/h3-4,6,8H,1-2,5,7H2,(H,15,19)/b10-6-/t8-/m0/s1 |
| InChIKey | DGEXNZHQTKDLRX-KZSPTFSBSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|