C16H15NO2 — CID 2166410
(Z)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 2166410) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (Z)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2166410 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (Z)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccco1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H15NO2/c18-16(8-7-15-6-3-11-19-15)17-10-9-13-4-1-2-5-14(13)12-17/h1-8,11H,9-10,12H2/b8-7- |
| InChIKey | DDGHLHGGZLYHOR-FPLPWBNLSA-N |
| XLogP | 2.88 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|