C14H17F4N3O5 — CID 2166842
2,2,3,3-tetrafluoropropyl 5-[(2,6-dimethoxypyrimidin-4-yl)amino]-5-oxopentanoate (PubChem CID 2166842) has the molecular formula C14H17F4N3O5 and a molecular weight of 383.30 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 5-[(2,6-dimethoxypyrimidin-4-yl)amino]-5-oxopentanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 5-[(2,6-dimethoxypyrimidin-4-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 2166842 |
| Molecular Formula | C14H17F4N3O5 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 5-[(2,6-dimethoxypyrimidin-4-yl)amino]-5-oxopentanoate |
| SMILES | COc1cc(NC(=O)CCCC(=O)OCC(F)(F)C(F)F)nc(OC)n1 |
| InChI | InChI=1S/C14H17F4N3O5/c1-24-10-6-8(20-13(21-10)25-2)19-9(22)4-3-5-11(23)26-7-14(17,18)12(15)16/h6,12H,3-5,7H2,1-2H3,(H,19,20,21,22) |
| InChIKey | VVPPJZCCIMWZMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|